C20H18ClFN6O — CID 166475046
3-chloro-1-(cyanomethylamino)-6-[[6-(3-fluorooxetan-3-yl)-3-pyridinyl]methyl]-7,8-dihydro-5H-2,6-naphthyridine-4-carbonitrile (PubChem CID 166475046) has the molecular formula C20H18ClFN6O and a molecular weight of 412.86 g/mol. Its IUPAC name is 3-chloro-1-(cyanomethylamino)-6-[[6-(3-fluorooxetan-3-yl)-3-pyridinyl]methyl]-7,8-dihydro-5H-2,6-naphthyridine-4-carbonitrile.
| Compound Name | 3-chloro-1-(cyanomethylamino)-6-[[6-(3-fluorooxetan-3-yl)-3-pyridinyl]methyl]-7,8-dihydro-5H-2,6-naphthyridine-4-carbonitrile |
|---|---|
| PubChem CID | 166475046 |
| Molecular Formula | C20H18ClFN6O |
| Molecular Weight | 412.86 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | 3-chloro-1-(cyanomethylamino)-6-[[6-(3-fluorooxetan-3-yl)-3-pyridinyl]methyl]-7,8-dihydro-5H-2,6-naphthyridine-4-carbonitrile |
| SMILES | N#CCNc1nc(Cl)c(C#N)c2c1CCN(Cc1ccc(C3(F)COC3)nc1)C2 |
| InChI | InChI=1S/C20H18ClFN6O/c21-18-15(7-24)16-10-28(6-3-14(16)19(27-18)25-5-4-23)9-13-1-2-17(26-8-13)20(22)11-29-12-20/h1-2,8H,3,5-6,9-12H2,(H,25,27) |
| InChIKey | QRRGMGPPCGJWQO-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 97.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.86 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|