C23H25ClN6O2 — CID 166474870
3-chloro-1-(cyanomethylamino)-6-[[2-methyl-6-(oxan-4-yloxy)-3-pyridinyl]methyl]-7,8-dihydro-5H-2,6-naphthyridine-4-carbonitrile (PubChem CID 166474870) has the molecular formula C23H25ClN6O2 and a molecular weight of 452.95 g/mol. Its IUPAC name is 3-chloro-1-(cyanomethylamino)-6-[[2-methyl-6-(oxan-4-yloxy)-3-pyridinyl]methyl]-7,8-dihydro-5H-2,6-naphthyridine-4-carbonitrile.
| Compound Name | 3-chloro-1-(cyanomethylamino)-6-[[2-methyl-6-(oxan-4-yloxy)-3-pyridinyl]methyl]-7,8-dihydro-5H-2,6-naphthyridine-4-carbonitrile |
|---|---|
| PubChem CID | 166474870 |
| Molecular Formula | C23H25ClN6O2 |
| Molecular Weight | 452.95 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | 3-chloro-1-(cyanomethylamino)-6-[[2-methyl-6-(oxan-4-yloxy)-3-pyridinyl]methyl]-7,8-dihydro-5H-2,6-naphthyridine-4-carbonitrile |
| SMILES | Cc1nc(OC2CCOCC2)ccc1CN1CCc2c(NCC#N)nc(Cl)c(C#N)c2C1 |
| InChI | InChI=1S/C23H25ClN6O2/c1-15-16(2-3-21(28-15)32-17-5-10-31-11-6-17)13-30-9-4-18-20(14-30)19(12-26)22(24)29-23(18)27-8-7-25/h2-3,17H,4-6,8-11,13-14H2,1H3,(H,27,29) |
| InChIKey | UFUBYFJOSIPAJA-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 107.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.95 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|