C20H19ClF2N6O — CID 166474869
3-chloro-1-(cyanomethylamino)-6-[1-[6-(2,2-difluoroethoxy)-3-pyridinyl]ethyl]-7,8-dihydro-5H-2,6-naphthyridine-4-carbonitrile (PubChem CID 166474869) has the molecular formula C20H19ClF2N6O and a molecular weight of 432.86 g/mol. Its IUPAC name is 3-chloro-1-(cyanomethylamino)-6-[1-[6-(2,2-difluoroethoxy)-3-pyridinyl]ethyl]-7,8-dihydro-5H-2,6-naphthyridine-4-carbonitrile.
| Compound Name | 3-chloro-1-(cyanomethylamino)-6-[1-[6-(2,2-difluoroethoxy)-3-pyridinyl]ethyl]-7,8-dihydro-5H-2,6-naphthyridine-4-carbonitrile |
|---|---|
| PubChem CID | 166474869 |
| Molecular Formula | C20H19ClF2N6O |
| Molecular Weight | 432.86 g/mol |
| Exact Mass | 432.13 |
| IUPAC Name | 3-chloro-1-(cyanomethylamino)-6-[1-[6-(2,2-difluoroethoxy)-3-pyridinyl]ethyl]-7,8-dihydro-5H-2,6-naphthyridine-4-carbonitrile |
| SMILES | CC(c1ccc(OCC(F)F)nc1)N1CCc2c(NCC#N)nc(Cl)c(C#N)c2C1 |
| InChI | InChI=1S/C20H19ClF2N6O/c1-12(13-2-3-18(27-9-13)30-11-17(22)23)29-7-4-14-16(10-29)15(8-25)19(21)28-20(14)26-6-5-24/h2-3,9,12,17H,4,6-7,10-11H2,1H3,(H,26,28) |
| InChIKey | YIFPIANRPQYFEG-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 97.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.86 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|