C21H21ClN4 — CID 166474946
3-chloro-6-[(2,6-dimethyl-3-pyridinyl)methyl]-4-ethynyl-N-prop-2-ynyl-7,8-dihydro-5H-2,6-naphthyridin-1-amine (PubChem CID 166474946) has the molecular formula C21H21ClN4 and a molecular weight of 364.88 g/mol. Its IUPAC name is 3-chloro-6-[(2,6-dimethyl-3-pyridinyl)methyl]-4-ethynyl-N-prop-2-ynyl-7,8-dihydro-5H-2,6-naphthyridin-1-amine.
| Compound Name | 3-chloro-6-[(2,6-dimethyl-3-pyridinyl)methyl]-4-ethynyl-N-prop-2-ynyl-7,8-dihydro-5H-2,6-naphthyridin-1-amine |
|---|---|
| PubChem CID | 166474946 |
| Molecular Formula | C21H21ClN4 |
| Molecular Weight | 364.88 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | 3-chloro-6-[(2,6-dimethyl-3-pyridinyl)methyl]-4-ethynyl-N-prop-2-ynyl-7,8-dihydro-5H-2,6-naphthyridin-1-amine |
| SMILES | C#CCNc1nc(Cl)c(C#C)c2c1CCN(Cc1ccc(C)nc1C)C2 |
| InChI | InChI=1S/C21H21ClN4/c1-5-10-23-21-18-9-11-26(12-16-8-7-14(3)24-15(16)4)13-19(18)17(6-2)20(22)25-21/h1-2,7-8H,9-13H2,3-4H3,(H,23,25) |
| InChIKey | RLMSHYZBVJWHAD-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.88 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|