C21H21ClN6O — CID 171988066
[4-(6-chloro-2-cyclobutylquinazolin-4-yl)piperazin-1-yl]-pyrimidin-5-ylmethanone (PubChem CID 171988066) has the molecular formula C21H21ClN6O and a molecular weight of 408.89 g/mol. Its IUPAC name is [4-(6-chloro-2-cyclobutylquinazolin-4-yl)piperazin-1-yl]-pyrimidin-5-ylmethanone.
| Compound Name | [4-(6-chloro-2-cyclobutylquinazolin-4-yl)piperazin-1-yl]-pyrimidin-5-ylmethanone |
|---|---|
| PubChem CID | 171988066 |
| Molecular Formula | C21H21ClN6O |
| Molecular Weight | 408.89 g/mol |
| Exact Mass | 408.15 |
| IUPAC Name | [4-(6-chloro-2-cyclobutylquinazolin-4-yl)piperazin-1-yl]-pyrimidin-5-ylmethanone |
| SMILES | O=C(c1cncnc1)N1CCN(c2nc(C3CCC3)nc3ccc(Cl)cc23)CC1 |
| InChI | InChI=1S/C21H21ClN6O/c22-16-4-5-18-17(10-16)20(26-19(25-18)14-2-1-3-14)27-6-8-28(9-7-27)21(29)15-11-23-13-24-12-15/h4-5,10-14H,1-3,6-9H2 |
| InChIKey | PUMOYVLJRGDPBM-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 75.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.89 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |