C19H21ClN4O — CID 42809373
[4-(7-chloro-2-cyclopropylquinazolin-4-yl)piperazin-1-yl]-cyclopropylmethanone (PubChem CID 42809373) has the molecular formula C19H21ClN4O and a molecular weight of 356.86 g/mol. Its IUPAC name is [4-(7-chloro-2-cyclopropylquinazolin-4-yl)piperazin-1-yl]-cyclopropylmethanone.
| Compound Name | [4-(7-chloro-2-cyclopropylquinazolin-4-yl)piperazin-1-yl]-cyclopropylmethanone |
|---|---|
| PubChem CID | 42809373 |
| Molecular Formula | C19H21ClN4O |
| Molecular Weight | 356.86 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | [4-(7-chloro-2-cyclopropylquinazolin-4-yl)piperazin-1-yl]-cyclopropylmethanone |
| SMILES | O=C(C1CC1)N1CCN(c2nc(C3CC3)nc3cc(Cl)ccc23)CC1 |
| InChI | InChI=1S/C19H21ClN4O/c20-14-5-6-15-16(11-14)21-17(12-1-2-12)22-18(15)23-7-9-24(10-8-23)19(25)13-3-4-13/h5-6,11-13H,1-4,7-10H2 |
| InChIKey | DDDLHHUZXQUZCJ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.86 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |