C27H27FN4O2 — CID 171988162
2-benzyl-4-[4-(4-fluorophenyl)piperazin-1-yl]-6,7-dimethoxyquinazoline (PubChem CID 171988162) has the molecular formula C27H27FN4O2 and a molecular weight of 458.54 g/mol. Its IUPAC name is 2-benzyl-4-[4-(4-fluorophenyl)piperazin-1-yl]-6,7-dimethoxyquinazoline.
| Compound Name | 2-benzyl-4-[4-(4-fluorophenyl)piperazin-1-yl]-6,7-dimethoxyquinazoline |
|---|---|
| PubChem CID | 171988162 |
| Molecular Formula | C27H27FN4O2 |
| Molecular Weight | 458.54 g/mol |
| Exact Mass | 458.21 |
| IUPAC Name | 2-benzyl-4-[4-(4-fluorophenyl)piperazin-1-yl]-6,7-dimethoxyquinazoline |
| SMILES | COc1cc2nc(Cc3ccccc3)nc(N3CCN(c4ccc(F)cc4)CC3)c2cc1OC |
| InChI | InChI=1S/C27H27FN4O2/c1-33-24-17-22-23(18-25(24)34-2)29-26(16-19-6-4-3-5-7-19)30-27(22)32-14-12-31(13-15-32)21-10-8-20(28)9-11-21/h3-11,17-18H,12-16H2,1-2H3 |
| InChIKey | GBJJFLPYTUFYGW-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 50.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.54 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |