C25H26N4OS — CID 91965057
2-benzyl-4-[4-(4-methoxyphenyl)piperazin-1-yl]-6-methylthieno[2,3-d]pyrimidine (PubChem CID 91965057) has the molecular formula C25H26N4OS and a molecular weight of 430.58 g/mol. Its IUPAC name is 2-benzyl-4-[4-(4-methoxyphenyl)piperazin-1-yl]-6-methylthieno[2,3-d]pyrimidine.
| Compound Name | 2-benzyl-4-[4-(4-methoxyphenyl)piperazin-1-yl]-6-methylthieno[2,3-d]pyrimidine |
|---|---|
| PubChem CID | 91965057 |
| Molecular Formula | C25H26N4OS |
| Molecular Weight | 430.58 g/mol |
| Exact Mass | 430.18 |
| IUPAC Name | 2-benzyl-4-[4-(4-methoxyphenyl)piperazin-1-yl]-6-methylthieno[2,3-d]pyrimidine |
| SMILES | COc1ccc(N2CCN(c3nc(Cc4ccccc4)nc4sc(C)cc34)CC2)cc1 |
| InChI | InChI=1S/C25H26N4OS/c1-18-16-22-24(26-23(27-25(22)31-18)17-19-6-4-3-5-7-19)29-14-12-28(13-15-29)20-8-10-21(30-2)11-9-20/h3-11,16H,12-15,17H2,1-2H3 |
| InChIKey | NRWOIYYWGPBCJM-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 41.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.58 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|