C26H31N3O2S — CID 171990653
5-amino-N-[(1R)-1-[3-[5-[[[(3R)-3-hydroxycyclopentyl]amino]methyl]thiophen-2-yl]phenyl]ethyl]-2-methylbenzamide (PubChem CID 171990653) has the molecular formula C26H31N3O2S and a molecular weight of 449.62 g/mol. Its IUPAC name is 5-amino-N-[(1R)-1-[3-[5-[[[(3R)-3-hydroxycyclopentyl]amino]methyl]thiophen-2-yl]phenyl]ethyl]-2-methylbenzamide.
| Compound Name | 5-amino-N-[(1R)-1-[3-[5-[[[(3R)-3-hydroxycyclopentyl]amino]methyl]thiophen-2-yl]phenyl]ethyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 171990653 |
| Molecular Formula | C26H31N3O2S |
| Molecular Weight | 449.62 g/mol |
| Exact Mass | 449.21 |
| IUPAC Name | 5-amino-N-[(1R)-1-[3-[5-[[[(3R)-3-hydroxycyclopentyl]amino]methyl]thiophen-2-yl]phenyl]ethyl]-2-methylbenzamide |
| SMILES | Cc1ccc(N)cc1C(=O)N[C@H](C)c1cccc(-c2ccc(CNC3CC[C@@H](O)C3)s2)c1 |
| InChI | InChI=1S/C26H31N3O2S/c1-16-6-7-20(27)13-24(16)26(31)29-17(2)18-4-3-5-19(12-18)25-11-10-23(32-25)15-28-21-8-9-22(30)14-21/h3-7,10-13,17,21-22,28,30H,8-9,14-15,27H2,1-2H3,(H,29,31)/t17-,21?,22-/m1/s1 |
| InChIKey | JBSVMHQPYPWXOR-PNWAUMQTSA-N |
| XLogP | 4.80 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.62 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|