C26H31N3OS — CID 174237486
5-amino-N-[1-[3-[5-[(cyclopentylamino)methyl]thiophen-2-yl]phenyl]ethyl]-2-methylbenzamide (PubChem CID 174237486) has the molecular formula C26H31N3OS and a molecular weight of 433.62 g/mol. Its IUPAC name is 5-amino-N-[1-[3-[5-[(cyclopentylamino)methyl]thiophen-2-yl]phenyl]ethyl]-2-methylbenzamide.
| Compound Name | 5-amino-N-[1-[3-[5-[(cyclopentylamino)methyl]thiophen-2-yl]phenyl]ethyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 174237486 |
| Molecular Formula | C26H31N3OS |
| Molecular Weight | 433.62 g/mol |
| Exact Mass | 433.22 |
| IUPAC Name | 5-amino-N-[1-[3-[5-[(cyclopentylamino)methyl]thiophen-2-yl]phenyl]ethyl]-2-methylbenzamide |
| SMILES | Cc1ccc(N)cc1C(=O)NC(C)c1cccc(-c2ccc(CNC3CCCC3)s2)c1 |
| InChI | InChI=1S/C26H31N3OS/c1-17-10-11-21(27)15-24(17)26(30)29-18(2)19-6-5-7-20(14-19)25-13-12-23(31-25)16-28-22-8-3-4-9-22/h5-7,10-15,18,22,28H,3-4,8-9,16,27H2,1-2H3,(H,29,30) |
| InChIKey | AXDZGQVONVRVOI-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.62 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|