C25H32N2O3 — CID 17199103
N-[4-(azepane-1-carbonyl)phenyl]-3-(3-methylbutoxy)benzamide (PubChem CID 17199103) has the molecular formula C25H32N2O3 and a molecular weight of 408.54 g/mol. Its IUPAC name is N-[4-(azepane-1-carbonyl)phenyl]-3-(3-methylbutoxy)benzamide.
| Compound Name | N-[4-(azepane-1-carbonyl)phenyl]-3-(3-methylbutoxy)benzamide |
|---|---|
| PubChem CID | 17199103 |
| Molecular Formula | C25H32N2O3 |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.24 |
| IUPAC Name | N-[4-(azepane-1-carbonyl)phenyl]-3-(3-methylbutoxy)benzamide |
| SMILES | CC(C)CCOc1cccc(C(=O)Nc2ccc(C(=O)N3CCCCCC3)cc2)c1 |
| InChI | InChI=1S/C25H32N2O3/c1-19(2)14-17-30-23-9-7-8-21(18-23)24(28)26-22-12-10-20(11-13-22)25(29)27-15-5-3-4-6-16-27/h7-13,18-19H,3-6,14-17H2,1-2H3,(H,26,28) |
| InChIKey | YFBMJWRICSLLTH-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |