C27H28N2O4 — CID 26168534
3-(2-phenoxyethoxy)-N-[3-(piperidine-1-carbonyl)phenyl]benzamide (PubChem CID 26168534) has the molecular formula C27H28N2O4 and a molecular weight of 444.53 g/mol. Its IUPAC name is 3-(2-phenoxyethoxy)-N-[3-(piperidine-1-carbonyl)phenyl]benzamide.
| Compound Name | 3-(2-phenoxyethoxy)-N-[3-(piperidine-1-carbonyl)phenyl]benzamide |
|---|---|
| PubChem CID | 26168534 |
| Molecular Formula | C27H28N2O4 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.20 |
| IUPAC Name | 3-(2-phenoxyethoxy)-N-[3-(piperidine-1-carbonyl)phenyl]benzamide |
| SMILES | O=C(Nc1cccc(C(=O)N2CCCCC2)c1)c1cccc(OCCOc2ccccc2)c1 |
| InChI | InChI=1S/C27H28N2O4/c30-26(28-23-11-7-10-22(19-23)27(31)29-15-5-2-6-16-29)21-9-8-14-25(20-21)33-18-17-32-24-12-3-1-4-13-24/h1,3-4,7-14,19-20H,2,5-6,15-18H2,(H,28,30) |
| InChIKey | JYIBWSXDBIUTPF-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|