C40H50N6O4 — CID 171991075
(2S)-6-amino-N-benzhydryl-2-[[(2S,3S)-2-[[(2S)-3-isoquinolin-3-yl-2-(propanoylamino)propanoyl]amino]-3-methylpentanoyl]amino]hexanamide (PubChem CID 171991075) has the molecular formula C40H50N6O4 and a molecular weight of 678.88 g/mol. Its IUPAC name is (2S)-6-amino-N-benzhydryl-2-[[(2S,3S)-2-[[(2S)-3-isoquinolin-3-yl-2-(propanoylamino)propanoyl]amino]-3-methylpentanoyl]amino]hexanamide.
| Compound Name | (2S)-6-amino-N-benzhydryl-2-[[(2S,3S)-2-[[(2S)-3-isoquinolin-3-yl-2-(propanoylamino)propanoyl]amino]-3-methylpentanoyl]amino]hexanamide |
|---|---|
| PubChem CID | 171991075 |
| Molecular Formula | C40H50N6O4 |
| Molecular Weight | 678.88 g/mol |
| Exact Mass | 678.39 |
| IUPAC Name | (2S)-6-amino-N-benzhydryl-2-[[(2S,3S)-2-[[(2S)-3-isoquinolin-3-yl-2-(propanoylamino)propanoyl]amino]-3-methylpentanoyl]amino]hexanamide |
| SMILES | CCC(=O)N[C@@H](Cc1cc2ccccc2cn1)C(=O)N[C@H](C(=O)N[C@@H](CCCCN)C(=O)NC(c1ccccc1)c1ccccc1)[C@@H](C)CC |
| InChI | InChI=1S/C40H50N6O4/c1-4-27(3)36(45-39(49)34(43-35(47)5-2)25-32-24-30-20-12-13-21-31(30)26-42-32)40(50)44-33(22-14-15-23-41)38(48)46-37(28-16-8-6-9-17-28)29-18-10-7-11-19-29/h6-13,16-21,24,26-27,33-34,36-37H,4-5,14-15,22-23,25,41H2,1-3H3,(H,43,47)(H,44,50)(H,45,49)(H,46,48)/t27-,33-,34-,36-/m0/s1 |
| InChIKey | GMJUTKUCBXWYIZ-SDWZQKNDSA-N |
| XLogP | 4.72 |
| TPSA | 155.31 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.88 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|