C24H32FN3O3 — CID 171992012
(1S,2S,8R,9R)-11-[2-(4-fluorophenyl)ethyl]-8-[(3S)-3-hydroxypyrrolidine-1-carbonyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one (PubChem CID 171992012) has the molecular formula C24H32FN3O3 and a molecular weight of 429.54 g/mol. Its IUPAC name is (1S,2S,8R,9R)-11-[2-(4-fluorophenyl)ethyl]-8-[(3S)-3-hydroxypyrrolidine-1-carbonyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one.
| Compound Name | (1S,2S,8R,9R)-11-[2-(4-fluorophenyl)ethyl]-8-[(3S)-3-hydroxypyrrolidine-1-carbonyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one |
|---|---|
| PubChem CID | 171992012 |
| Molecular Formula | C24H32FN3O3 |
| Molecular Weight | 429.54 g/mol |
| Exact Mass | 429.24 |
| IUPAC Name | (1S,2S,8R,9R)-11-[2-(4-fluorophenyl)ethyl]-8-[(3S)-3-hydroxypyrrolidine-1-carbonyl]-7,11-diazatricyclo[7.3.1.02,7]tridecan-6-one |
| SMILES | O=C([C@H]1[C@@H]2C[C@@H](CN(CCc3ccc(F)cc3)C2)[C@@H]2CCCC(=O)N21)N1CC[C@H](O)C1 |
| InChI | InChI=1S/C24H32FN3O3/c25-19-6-4-16(5-7-19)8-10-26-13-17-12-18(14-26)23(24(31)27-11-9-20(29)15-27)28-21(17)2-1-3-22(28)30/h4-7,17-18,20-21,23,29H,1-3,8-15H2/t17-,18+,20-,21-,23+/m0/s1 |
| InChIKey | SETYYENCFCXNHQ-ZEVUWQFRSA-N |
| XLogP | 1.66 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.54 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |