C15H21BrN4O2S — CID 171993187
1-(5-bromo-2-methylsulfanylpyrimidin-4-yl)-N-(oxan-4-yl)pyrrolidine-3-carboxamide (PubChem CID 171993187) has the molecular formula C15H21BrN4O2S and a molecular weight of 401.33 g/mol. Its IUPAC name is 1-(5-bromo-2-methylsulfanylpyrimidin-4-yl)-N-(oxan-4-yl)pyrrolidine-3-carboxamide.
| Compound Name | 1-(5-bromo-2-methylsulfanylpyrimidin-4-yl)-N-(oxan-4-yl)pyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 171993187 |
| Molecular Formula | C15H21BrN4O2S |
| Molecular Weight | 401.33 g/mol |
| Exact Mass | 400.06 |
| IUPAC Name | 1-(5-bromo-2-methylsulfanylpyrimidin-4-yl)-N-(oxan-4-yl)pyrrolidine-3-carboxamide |
| SMILES | CSc1ncc(Br)c(N2CCC(C(=O)NC3CCOCC3)C2)n1 |
| InChI | InChI=1S/C15H21BrN4O2S/c1-23-15-17-8-12(16)13(19-15)20-5-2-10(9-20)14(21)18-11-3-6-22-7-4-11/h8,10-11H,2-7,9H2,1H3,(H,18,21) |
| InChIKey | HZCPGBYVIWGHPP-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.33 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |