C16H18BrN5OS — CID 175649792
N-[1-(5-bromo-2-methylsulfanylpyrimidin-4-yl)piperidin-4-yl]pyridine-3-carboxamide (PubChem CID 175649792) has the molecular formula C16H18BrN5OS and a molecular weight of 408.33 g/mol. Its IUPAC name is N-[1-(5-bromo-2-methylsulfanylpyrimidin-4-yl)piperidin-4-yl]pyridine-3-carboxamide.
| Compound Name | N-[1-(5-bromo-2-methylsulfanylpyrimidin-4-yl)piperidin-4-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 175649792 |
| Molecular Formula | C16H18BrN5OS |
| Molecular Weight | 408.33 g/mol |
| Exact Mass | 407.04 |
| IUPAC Name | N-[1-(5-bromo-2-methylsulfanylpyrimidin-4-yl)piperidin-4-yl]pyridine-3-carboxamide |
| SMILES | CSc1ncc(Br)c(N2CCC(NC(=O)c3cccnc3)CC2)n1 |
| InChI | InChI=1S/C16H18BrN5OS/c1-24-16-19-10-13(17)14(21-16)22-7-4-12(5-8-22)20-15(23)11-3-2-6-18-9-11/h2-3,6,9-10,12H,4-5,7-8H2,1H3,(H,20,23) |
| InChIKey | USFDMSZJNVMGPC-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 71.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.33 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |