C16H18BrN5O2 — CID 175649555
N-[1-(5-bromo-4-methoxypyrimidin-2-yl)piperidin-4-yl]pyridine-3-carboxamide (PubChem CID 175649555) has the molecular formula C16H18BrN5O2 and a molecular weight of 392.26 g/mol. Its IUPAC name is N-[1-(5-bromo-4-methoxypyrimidin-2-yl)piperidin-4-yl]pyridine-3-carboxamide.
| Compound Name | N-[1-(5-bromo-4-methoxypyrimidin-2-yl)piperidin-4-yl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 175649555 |
| Molecular Formula | C16H18BrN5O2 |
| Molecular Weight | 392.26 g/mol |
| Exact Mass | 391.06 |
| IUPAC Name | N-[1-(5-bromo-4-methoxypyrimidin-2-yl)piperidin-4-yl]pyridine-3-carboxamide |
| SMILES | COc1nc(N2CCC(NC(=O)c3cccnc3)CC2)ncc1Br |
| InChI | InChI=1S/C16H18BrN5O2/c1-24-15-13(17)10-19-16(21-15)22-7-4-12(5-8-22)20-14(23)11-3-2-6-18-9-11/h2-3,6,9-10,12H,4-5,7-8H2,1H3,(H,20,23) |
| InChIKey | BXOVGNLDPGIJTD-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 80.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.26 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |