C17H18ClN5 — CID 171996720
2-chloro-6-[3-[methyl-(4-methylpyrimidin-2-yl)amino]pyrrolidin-1-yl]benzonitrile (PubChem CID 171996720) has the molecular formula C17H18ClN5 and a molecular weight of 327.82 g/mol. Its IUPAC name is 2-chloro-6-[3-[methyl-(4-methylpyrimidin-2-yl)amino]pyrrolidin-1-yl]benzonitrile.
| Compound Name | 2-chloro-6-[3-[methyl-(4-methylpyrimidin-2-yl)amino]pyrrolidin-1-yl]benzonitrile |
|---|---|
| PubChem CID | 171996720 |
| Molecular Formula | C17H18ClN5 |
| Molecular Weight | 327.82 g/mol |
| Exact Mass | 327.13 |
| IUPAC Name | 2-chloro-6-[3-[methyl-(4-methylpyrimidin-2-yl)amino]pyrrolidin-1-yl]benzonitrile |
| SMILES | Cc1ccnc(N(C)C2CCN(c3cccc(Cl)c3C#N)C2)n1 |
| InChI | InChI=1S/C17H18ClN5/c1-12-6-8-20-17(21-12)22(2)13-7-9-23(11-13)16-5-3-4-15(18)14(16)10-19/h3-6,8,13H,7,9,11H2,1-2H3 |
| InChIKey | GQXZONICDQBNMC-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 56.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.82 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |