C18H20ClN5O — CID 171999536
2-chloro-6-[3-[(6-methoxypyrimidin-4-yl)-methylamino]piperidin-1-yl]benzonitrile (PubChem CID 171999536) has the molecular formula C18H20ClN5O and a molecular weight of 357.85 g/mol. Its IUPAC name is 2-chloro-6-[3-[(6-methoxypyrimidin-4-yl)-methylamino]piperidin-1-yl]benzonitrile.
| Compound Name | 2-chloro-6-[3-[(6-methoxypyrimidin-4-yl)-methylamino]piperidin-1-yl]benzonitrile |
|---|---|
| PubChem CID | 171999536 |
| Molecular Formula | C18H20ClN5O |
| Molecular Weight | 357.85 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | 2-chloro-6-[3-[(6-methoxypyrimidin-4-yl)-methylamino]piperidin-1-yl]benzonitrile |
| SMILES | COc1cc(N(C)C2CCCN(c3cccc(Cl)c3C#N)C2)ncn1 |
| InChI | InChI=1S/C18H20ClN5O/c1-23(17-9-18(25-2)22-12-21-17)13-5-4-8-24(11-13)16-7-3-6-15(19)14(16)10-20/h3,6-7,9,12-13H,4-5,8,11H2,1-2H3 |
| InChIKey | SSMFNFGQFOBWKV-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 65.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.85 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |