C18H21ClN6 — CID 171997168
3-chloro-4-[3-[[6-(dimethylamino)pyrimidin-4-yl]-methylamino]pyrrolidin-1-yl]benzonitrile (PubChem CID 171997168) has the molecular formula C18H21ClN6 and a molecular weight of 356.86 g/mol. Its IUPAC name is 3-chloro-4-[3-[[6-(dimethylamino)pyrimidin-4-yl]-methylamino]pyrrolidin-1-yl]benzonitrile.
| Compound Name | 3-chloro-4-[3-[[6-(dimethylamino)pyrimidin-4-yl]-methylamino]pyrrolidin-1-yl]benzonitrile |
|---|---|
| PubChem CID | 171997168 |
| Molecular Formula | C18H21ClN6 |
| Molecular Weight | 356.86 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | 3-chloro-4-[3-[[6-(dimethylamino)pyrimidin-4-yl]-methylamino]pyrrolidin-1-yl]benzonitrile |
| SMILES | CN(C)c1cc(N(C)C2CCN(c3ccc(C#N)cc3Cl)C2)ncn1 |
| InChI | InChI=1S/C18H21ClN6/c1-23(2)17-9-18(22-12-21-17)24(3)14-6-7-25(11-14)16-5-4-13(10-20)8-15(16)19/h4-5,8-9,12,14H,6-7,11H2,1-3H3 |
| InChIKey | RJFXXBRILMBGES-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 59.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.86 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |