C13H15ClN2O — CID 60677826
2-chloro-6-[3-(hydroxymethyl)piperidin-1-yl]benzonitrile (PubChem CID 60677826) has the molecular formula C13H15ClN2O and a molecular weight of 250.73 g/mol. Its IUPAC name is 2-chloro-6-[3-(hydroxymethyl)piperidin-1-yl]benzonitrile.
| Compound Name | 2-chloro-6-[3-(hydroxymethyl)piperidin-1-yl]benzonitrile |
|---|---|
| PubChem CID | 60677826 |
| Molecular Formula | C13H15ClN2O |
| Molecular Weight | 250.73 g/mol |
| Exact Mass | 250.09 |
| IUPAC Name | 2-chloro-6-[3-(hydroxymethyl)piperidin-1-yl]benzonitrile |
| SMILES | N#Cc1c(Cl)cccc1N1CCCC(CO)C1 |
| InChI | InChI=1S/C13H15ClN2O/c14-12-4-1-5-13(11(12)7-15)16-6-2-3-10(8-16)9-17/h1,4-5,10,17H,2-3,6,8-9H2 |
| InChIKey | WNRSLKPRMVRLNE-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 47.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.73 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |