C18H24N8 — CID 171996785
6-[4-[(1-methyl-4,5,6,7-tetrahydroindazol-3-yl)methyl]piperazin-1-yl]-[1,2,4]triazolo[4,3-b]pyridazine (PubChem CID 171996785) has the molecular formula C18H24N8 and a molecular weight of 352.45 g/mol. Its IUPAC name is 6-[4-[(1-methyl-4,5,6,7-tetrahydroindazol-3-yl)methyl]piperazin-1-yl]-[1,2,4]triazolo[4,3-b]pyridazine.
| Compound Name | 6-[4-[(1-methyl-4,5,6,7-tetrahydroindazol-3-yl)methyl]piperazin-1-yl]-[1,2,4]triazolo[4,3-b]pyridazine |
|---|---|
| PubChem CID | 171996785 |
| Molecular Formula | C18H24N8 |
| Molecular Weight | 352.45 g/mol |
| Exact Mass | 352.21 |
| IUPAC Name | 6-[4-[(1-methyl-4,5,6,7-tetrahydroindazol-3-yl)methyl]piperazin-1-yl]-[1,2,4]triazolo[4,3-b]pyridazine |
| SMILES | Cn1nc(CN2CCN(c3ccc4nncn4n3)CC2)c2c1CCCC2 |
| InChI | InChI=1S/C18H24N8/c1-23-16-5-3-2-4-14(16)15(21-23)12-24-8-10-25(11-9-24)18-7-6-17-20-19-13-26(17)22-18/h6-7,13H,2-5,8-12H2,1H3 |
| InChIKey | ZFIIKVNXMUJRRS-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 67.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.45 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |