C17H18N4OS — CID 171997932
6-(4,5-dimethyl-1,3-benzothiazol-2-yl)-2-methyl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one (PubChem CID 171997932) has the molecular formula C17H18N4OS and a molecular weight of 326.43 g/mol. Its IUPAC name is 6-(4,5-dimethyl-1,3-benzothiazol-2-yl)-2-methyl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 6-(4,5-dimethyl-1,3-benzothiazol-2-yl)-2-methyl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 171997932 |
| Molecular Formula | C17H18N4OS |
| Molecular Weight | 326.43 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | 6-(4,5-dimethyl-1,3-benzothiazol-2-yl)-2-methyl-3,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
| SMILES | Cc1nc2c(c(=O)[nH]1)CN(c1nc3c(C)c(C)ccc3s1)CC2 |
| InChI | InChI=1S/C17H18N4OS/c1-9-4-5-14-15(10(9)2)20-17(23-14)21-7-6-13-12(8-21)16(22)19-11(3)18-13/h4-5H,6-8H2,1-3H3,(H,18,19,22) |
| InChIKey | SXWQUOWOMXIFPI-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.43 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |