C22H22N2O2 — CID 171999865
2-cyclobutyl-N-(2,4-dimethylphenyl)-1-oxoisoquinoline-3-carboxamide (PubChem CID 171999865) has the molecular formula C22H22N2O2 and a molecular weight of 346.43 g/mol. Its IUPAC name is 2-cyclobutyl-N-(2,4-dimethylphenyl)-1-oxoisoquinoline-3-carboxamide.
| Compound Name | 2-cyclobutyl-N-(2,4-dimethylphenyl)-1-oxoisoquinoline-3-carboxamide |
|---|---|
| PubChem CID | 171999865 |
| Molecular Formula | C22H22N2O2 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.17 |
| IUPAC Name | 2-cyclobutyl-N-(2,4-dimethylphenyl)-1-oxoisoquinoline-3-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2cc3ccccc3c(=O)n2C2CCC2)c(C)c1 |
| InChI | InChI=1S/C22H22N2O2/c1-14-10-11-19(15(2)12-14)23-21(25)20-13-16-6-3-4-9-18(16)22(26)24(20)17-7-5-8-17/h3-4,6,9-13,17H,5,7-8H2,1-2H3,(H,23,25) |
| InChIKey | IJVTUDAQUWHLAB-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |