C18H15NO2S — CID 17015275
N-(2,4-dimethylphenyl)-1-oxoisothiochromene-3-carboxamide (PubChem CID 17015275) has the molecular formula C18H15NO2S and a molecular weight of 309.39 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-1-oxoisothiochromene-3-carboxamide.
| Compound Name | N-(2,4-dimethylphenyl)-1-oxoisothiochromene-3-carboxamide |
|---|---|
| PubChem CID | 17015275 |
| Molecular Formula | C18H15NO2S |
| Molecular Weight | 309.39 g/mol |
| Exact Mass | 309.08 |
| IUPAC Name | N-(2,4-dimethylphenyl)-1-oxoisothiochromene-3-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2cc3ccccc3c(=O)s2)c(C)c1 |
| InChI | InChI=1S/C18H15NO2S/c1-11-7-8-15(12(2)9-11)19-17(20)16-10-13-5-3-4-6-14(13)18(21)22-16/h3-10H,1-2H3,(H,19,20) |
| InChIKey | QCWRCVQAWQSJEA-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.39 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |