C27H21NO2 — CID 17201995
1,3-bis(4-methoxyphenyl)benzo[f]quinoline (PubChem CID 17201995) has the molecular formula C27H21NO2 and a molecular weight of 391.47 g/mol. Its IUPAC name is 1,3-bis(4-methoxyphenyl)benzo[f]quinoline.
| Compound Name | 1,3-bis(4-methoxyphenyl)benzo[f]quinoline |
|---|---|
| PubChem CID | 17201995 |
| Molecular Formula | C27H21NO2 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | 1,3-bis(4-methoxyphenyl)benzo[f]quinoline |
| SMILES | COc1ccc(-c2cc(-c3ccc(OC)cc3)c3c(ccc4ccccc43)n2)cc1 |
| InChI | InChI=1S/C27H21NO2/c1-29-21-12-7-19(8-13-21)24-17-26(20-9-14-22(30-2)15-10-20)28-25-16-11-18-5-3-4-6-23(18)27(24)25/h3-17H,1-2H3 |
| InChIKey | VBDQKBCDMKNGIW-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|