C27H20FNO2 — CID 44613761
3-(3,5-dimethoxyphenyl)-1-(4-fluorophenyl)benzo[f]quinoline (PubChem CID 44613761) has the molecular formula C27H20FNO2 and a molecular weight of 409.46 g/mol. Its IUPAC name is 3-(3,5-dimethoxyphenyl)-1-(4-fluorophenyl)benzo[f]quinoline.
| Compound Name | 3-(3,5-dimethoxyphenyl)-1-(4-fluorophenyl)benzo[f]quinoline |
|---|---|
| PubChem CID | 44613761 |
| Molecular Formula | C27H20FNO2 |
| Molecular Weight | 409.46 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | 3-(3,5-dimethoxyphenyl)-1-(4-fluorophenyl)benzo[f]quinoline |
| SMILES | COc1cc(OC)cc(-c2cc(-c3ccc(F)cc3)c3c(ccc4ccccc43)n2)c1 |
| InChI | InChI=1S/C27H20FNO2/c1-30-21-13-19(14-22(15-21)31-2)26-16-24(18-7-10-20(28)11-8-18)27-23-6-4-3-5-17(23)9-12-25(27)29-26/h3-16H,1-2H3 |
| InChIKey | LACIGOIRHBWTSA-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.46 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|