C25H32N2O4 — CID 17202386
3-[2-(4-tert-butylphenoxy)propanoylamino]-N-(oxolan-2-ylmethyl)benzamide (PubChem CID 17202386) has the molecular formula C25H32N2O4 and a molecular weight of 424.54 g/mol. Its IUPAC name is 3-[2-(4-tert-butylphenoxy)propanoylamino]-N-(oxolan-2-ylmethyl)benzamide.
| Compound Name | 3-[2-(4-tert-butylphenoxy)propanoylamino]-N-(oxolan-2-ylmethyl)benzamide |
|---|---|
| PubChem CID | 17202386 |
| Molecular Formula | C25H32N2O4 |
| Molecular Weight | 424.54 g/mol |
| Exact Mass | 424.24 |
| IUPAC Name | 3-[2-(4-tert-butylphenoxy)propanoylamino]-N-(oxolan-2-ylmethyl)benzamide |
| SMILES | CC(Oc1ccc(C(C)(C)C)cc1)C(=O)Nc1cccc(C(=O)NCC2CCCO2)c1 |
| InChI | InChI=1S/C25H32N2O4/c1-17(31-21-12-10-19(11-13-21)25(2,3)4)23(28)27-20-8-5-7-18(15-20)24(29)26-16-22-9-6-14-30-22/h5,7-8,10-13,15,17,22H,6,9,14,16H2,1-4H3,(H,26,29)(H,27,28) |
| InChIKey | DOVWBOYAHRPVJB-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.54 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |