C18H28Cl2N2O — CID 17215613
N'-[(2-ethoxynaphthalen-1-yl)methyl]-N-ethylpropane-1,3-diamine;dihydrochloride (PubChem CID 17215613) has the molecular formula C18H28Cl2N2O and a molecular weight of 359.34 g/mol. Its IUPAC name is N'-[(2-ethoxynaphthalen-1-yl)methyl]-N-ethylpropane-1,3-diamine;dihydrochloride.
| Compound Name | N'-[(2-ethoxynaphthalen-1-yl)methyl]-N-ethylpropane-1,3-diamine;dihydrochloride |
|---|---|
| PubChem CID | 17215613 |
| Molecular Formula | C18H28Cl2N2O |
| Molecular Weight | 359.34 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | N'-[(2-ethoxynaphthalen-1-yl)methyl]-N-ethylpropane-1,3-diamine;dihydrochloride |
| SMILES | CCNCCCNCc1c(OCC)ccc2ccccc12.Cl.Cl |
| InChI | InChI=1S/C18H26N2O.2ClH/c1-3-19-12-7-13-20-14-17-16-9-6-5-8-15(16)10-11-18(17)21-4-2;;/h5-6,8-11,19-20H,3-4,7,12-14H2,1-2H3;2*1H |
| InChIKey | DIHCIFCNKJNIIT-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.34 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|