C21H31NO — CID 4722807
N-[(2-ethoxynaphthalen-1-yl)methyl]octan-1-amine (PubChem CID 4722807) has the molecular formula C21H31NO and a molecular weight of 313.49 g/mol. Its IUPAC name is N-[(2-ethoxynaphthalen-1-yl)methyl]octan-1-amine.
| Compound Name | N-[(2-ethoxynaphthalen-1-yl)methyl]octan-1-amine |
|---|---|
| PubChem CID | 4722807 |
| Molecular Formula | C21H31NO |
| Molecular Weight | 313.49 g/mol |
| Exact Mass | 313.24 |
| IUPAC Name | N-[(2-ethoxynaphthalen-1-yl)methyl]octan-1-amine |
| SMILES | CCCCCCCCNCc1c(OCC)ccc2ccccc12 |
| InChI | InChI=1S/C21H31NO/c1-3-5-6-7-8-11-16-22-17-20-19-13-10-9-12-18(19)14-15-21(20)23-4-2/h9-10,12-15,22H,3-8,11,16-17H2,1-2H3 |
| InChIKey | JTKOVGAVPLOQOG-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.49 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|