C24H36N2O2 — CID 17053671
N-tert-butyl-2-[1-[(heptylamino)methyl]naphthalen-2-yl]oxyacetamide (PubChem CID 17053671) has the molecular formula C24H36N2O2 and a molecular weight of 384.56 g/mol. Its IUPAC name is N-tert-butyl-2-[1-[(heptylamino)methyl]naphthalen-2-yl]oxyacetamide.
| Compound Name | N-tert-butyl-2-[1-[(heptylamino)methyl]naphthalen-2-yl]oxyacetamide |
|---|---|
| PubChem CID | 17053671 |
| Molecular Formula | C24H36N2O2 |
| Molecular Weight | 384.56 g/mol |
| Exact Mass | 384.28 |
| IUPAC Name | N-tert-butyl-2-[1-[(heptylamino)methyl]naphthalen-2-yl]oxyacetamide |
| SMILES | CCCCCCCNCc1c(OCC(=O)NC(C)(C)C)ccc2ccccc12 |
| InChI | InChI=1S/C24H36N2O2/c1-5-6-7-8-11-16-25-17-21-20-13-10-9-12-19(20)14-15-22(21)28-18-23(27)26-24(2,3)4/h9-10,12-15,25H,5-8,11,16-18H2,1-4H3,(H,26,27) |
| InChIKey | JIQPETAWBODIIO-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.56 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|