C21H33Cl2N3O2 — CID 17053720
N-tert-butyl-2-[1-[[3-(methylamino)propylamino]methyl]naphthalen-2-yl]oxyacetamide;dihydrochloride (PubChem CID 17053720) has the molecular formula C21H33Cl2N3O2 and a molecular weight of 430.42 g/mol. Its IUPAC name is N-tert-butyl-2-[1-[[3-(methylamino)propylamino]methyl]naphthalen-2-yl]oxyacetamide;dihydrochloride.
| Compound Name | N-tert-butyl-2-[1-[[3-(methylamino)propylamino]methyl]naphthalen-2-yl]oxyacetamide;dihydrochloride |
|---|---|
| PubChem CID | 17053720 |
| Molecular Formula | C21H33Cl2N3O2 |
| Molecular Weight | 430.42 g/mol |
| Exact Mass | 429.19 |
| IUPAC Name | N-tert-butyl-2-[1-[[3-(methylamino)propylamino]methyl]naphthalen-2-yl]oxyacetamide;dihydrochloride |
| SMILES | CNCCCNCc1c(OCC(=O)NC(C)(C)C)ccc2ccccc12.Cl.Cl |
| InChI | InChI=1S/C21H31N3O2.2ClH/c1-21(2,3)24-20(25)15-26-19-11-10-16-8-5-6-9-17(16)18(19)14-23-13-7-12-22-4;;/h5-6,8-11,22-23H,7,12-15H2,1-4H3,(H,24,25);2*1H |
| InChIKey | IECKRQSAYAVJDC-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 62.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.42 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|