C25H38N2O2 — CID 17053725
N-tert-butyl-2-[1-[(octylamino)methyl]naphthalen-2-yl]oxyacetamide (PubChem CID 17053725) has the molecular formula C25H38N2O2 and a molecular weight of 398.59 g/mol. Its IUPAC name is N-tert-butyl-2-[1-[(octylamino)methyl]naphthalen-2-yl]oxyacetamide.
| Compound Name | N-tert-butyl-2-[1-[(octylamino)methyl]naphthalen-2-yl]oxyacetamide |
|---|---|
| PubChem CID | 17053725 |
| Molecular Formula | C25H38N2O2 |
| Molecular Weight | 398.59 g/mol |
| Exact Mass | 398.29 |
| IUPAC Name | N-tert-butyl-2-[1-[(octylamino)methyl]naphthalen-2-yl]oxyacetamide |
| SMILES | CCCCCCCCNCc1c(OCC(=O)NC(C)(C)C)ccc2ccccc12 |
| InChI | InChI=1S/C25H38N2O2/c1-5-6-7-8-9-12-17-26-18-22-21-14-11-10-13-20(21)15-16-23(22)29-19-24(28)27-25(2,3)4/h10-11,13-16,26H,5-9,12,17-19H2,1-4H3,(H,27,28) |
| InChIKey | KTKPAITZARISFP-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.59 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|