C21H30N2O2 — CID 17053675
2-[1-[(butan-2-ylamino)methyl]naphthalen-2-yl]oxy-N-tert-butylacetamide (PubChem CID 17053675) has the molecular formula C21H30N2O2 and a molecular weight of 342.48 g/mol. Its IUPAC name is 2-[1-[(butan-2-ylamino)methyl]naphthalen-2-yl]oxy-N-tert-butylacetamide.
| Compound Name | 2-[1-[(butan-2-ylamino)methyl]naphthalen-2-yl]oxy-N-tert-butylacetamide |
|---|---|
| PubChem CID | 17053675 |
| Molecular Formula | C21H30N2O2 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.23 |
| IUPAC Name | 2-[1-[(butan-2-ylamino)methyl]naphthalen-2-yl]oxy-N-tert-butylacetamide |
| SMILES | CCC(C)NCc1c(OCC(=O)NC(C)(C)C)ccc2ccccc12 |
| InChI | InChI=1S/C21H30N2O2/c1-6-15(2)22-13-18-17-10-8-7-9-16(17)11-12-19(18)25-14-20(24)23-21(3,4)5/h7-12,15,22H,6,13-14H2,1-5H3,(H,23,24) |
| InChIKey | ASTJMCBUJKDJQC-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |