C25H36N2O2 — CID 17053729
N-tert-butyl-2-[1-[(cyclooctylamino)methyl]naphthalen-2-yl]oxyacetamide (PubChem CID 17053729) has the molecular formula C25H36N2O2 and a molecular weight of 396.58 g/mol. Its IUPAC name is N-tert-butyl-2-[1-[(cyclooctylamino)methyl]naphthalen-2-yl]oxyacetamide.
| Compound Name | N-tert-butyl-2-[1-[(cyclooctylamino)methyl]naphthalen-2-yl]oxyacetamide |
|---|---|
| PubChem CID | 17053729 |
| Molecular Formula | C25H36N2O2 |
| Molecular Weight | 396.58 g/mol |
| Exact Mass | 396.28 |
| IUPAC Name | N-tert-butyl-2-[1-[(cyclooctylamino)methyl]naphthalen-2-yl]oxyacetamide |
| SMILES | CC(C)(C)NC(=O)COc1ccc2ccccc2c1CNC1CCCCCCC1 |
| InChI | InChI=1S/C25H36N2O2/c1-25(2,3)27-24(28)18-29-23-16-15-19-11-9-10-14-21(19)22(23)17-26-20-12-7-5-4-6-8-13-20/h9-11,14-16,20,26H,4-8,12-13,17-18H2,1-3H3,(H,27,28) |
| InChIKey | ACTYIEZVERBJSS-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.58 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |