C23H34Cl2N2O4 — CID 17216059
2-(3,4-dimethoxyphenyl)-N-[[4-methoxy-3-(morpholin-4-ylmethyl)phenyl]methyl]ethanamine;dihydrochloride (PubChem CID 17216059) has the molecular formula C23H34Cl2N2O4 and a molecular weight of 473.44 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-N-[[4-methoxy-3-(morpholin-4-ylmethyl)phenyl]methyl]ethanamine;dihydrochloride.
| Compound Name | 2-(3,4-dimethoxyphenyl)-N-[[4-methoxy-3-(morpholin-4-ylmethyl)phenyl]methyl]ethanamine;dihydrochloride |
|---|---|
| PubChem CID | 17216059 |
| Molecular Formula | C23H34Cl2N2O4 |
| Molecular Weight | 473.44 g/mol |
| Exact Mass | 472.19 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-N-[[4-methoxy-3-(morpholin-4-ylmethyl)phenyl]methyl]ethanamine;dihydrochloride |
| SMILES | COc1ccc(CNCCc2ccc(OC)c(OC)c2)cc1CN1CCOCC1.Cl.Cl |
| InChI | InChI=1S/C23H32N2O4.2ClH/c1-26-21-6-5-19(14-20(21)17-25-10-12-29-13-11-25)16-24-9-8-18-4-7-22(27-2)23(15-18)28-3;;/h4-7,14-15,24H,8-13,16-17H2,1-3H3;2*1H |
| InChIKey | VQZWZTHBOUUQHO-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 52.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.44 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anisol_B(2)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|