C21H30Cl2N2O3 — CID 17216101
2-[[4-methoxy-3-(morpholin-4-ylmethyl)phenyl]methylamino]-1-phenylethanol;dihydrochloride (PubChem CID 17216101) has the molecular formula C21H30Cl2N2O3 and a molecular weight of 429.39 g/mol. Its IUPAC name is 2-[[4-methoxy-3-(morpholin-4-ylmethyl)phenyl]methylamino]-1-phenylethanol;dihydrochloride.
| Compound Name | 2-[[4-methoxy-3-(morpholin-4-ylmethyl)phenyl]methylamino]-1-phenylethanol;dihydrochloride |
|---|---|
| PubChem CID | 17216101 |
| Molecular Formula | C21H30Cl2N2O3 |
| Molecular Weight | 429.39 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | 2-[[4-methoxy-3-(morpholin-4-ylmethyl)phenyl]methylamino]-1-phenylethanol;dihydrochloride |
| SMILES | COc1ccc(CNCC(O)c2ccccc2)cc1CN1CCOCC1.Cl.Cl |
| InChI | InChI=1S/C21H28N2O3.2ClH/c1-25-21-8-7-17(13-19(21)16-23-9-11-26-12-10-23)14-22-15-20(24)18-5-3-2-4-6-18;;/h2-8,13,20,22,24H,9-12,14-16H2,1H3;2*1H |
| InChIKey | FAUVHCMDMYHASO-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 53.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.39 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anisol_B(2)', 'substructure': 'N/A'} |
|---|