C16H20N2O2 — CID 17218078
3,5-dimethyl-N-(4-phenylbutan-2-yl)-1,2-oxazole-4-carboxamide (PubChem CID 17218078) has the molecular formula C16H20N2O2 and a molecular weight of 272.35 g/mol. Its IUPAC name is 3,5-dimethyl-N-(4-phenylbutan-2-yl)-1,2-oxazole-4-carboxamide.
| Compound Name | 3,5-dimethyl-N-(4-phenylbutan-2-yl)-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 17218078 |
| Molecular Formula | C16H20N2O2 |
| Molecular Weight | 272.35 g/mol |
| Exact Mass | 272.15 |
| IUPAC Name | 3,5-dimethyl-N-(4-phenylbutan-2-yl)-1,2-oxazole-4-carboxamide |
| SMILES | Cc1noc(C)c1C(=O)NC(C)CCc1ccccc1 |
| InChI | InChI=1S/C16H20N2O2/c1-11(9-10-14-7-5-4-6-8-14)17-16(19)15-12(2)18-20-13(15)3/h4-8,11H,9-10H2,1-3H3,(H,17,19) |
| InChIKey | VFGIMRSFVDWAFM-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.35 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |