5-[(3,5-dimethyl-1,2-oxazole-4-carbonyl)amino]hexanoic acid

C12H18N2O4 — CID 82854561

IUPAC5-[(3,5-dimethyl-1,2-oxazole-4-carbonyl)amino]hexanoic acid
SMILESCc1noc(C)c1C(=O)NC(C)CCCC(=O)O
InChIInChI=1S/C12H18N2O4/c1-7(5-4-6-10(15)16)13-12(17)11-8(2)14-18-9(11)3/h7H,4-6H2,1-3H3,(H,13,17)(H,15,16)
InChIKeyFMGLEPPFPXLRFB-UHFFFAOYSA-N
MW254.29 g/mol
LogP1.66
Rot. Bonds6

About 5-[(3,5-dimethyl-1,2-oxazole-4-carbonyl)amino]hexanoic acid

5-[(3,5-dimethyl-1,2-oxazole-4-carbonyl)amino]hexanoic acid (PubChem CID 82854561) has the molecular formula C12H18N2O4 and a molecular weight of 254.29 g/mol. Its IUPAC name is 5-[(3,5-dimethyl-1,2-oxazole-4-carbonyl)amino]hexanoic acid.

Molecular Properties

Compound Name5-[(3,5-dimethyl-1,2-oxazole-4-carbonyl)amino]hexanoic acid
PubChem CID82854561
Molecular FormulaC12H18N2O4
Molecular Weight254.29 g/mol
Exact Mass254.13
IUPAC Name5-[(3,5-dimethyl-1,2-oxazole-4-carbonyl)amino]hexanoic acid
SMILESCc1noc(C)c1C(=O)NC(C)CCCC(=O)O
InChIInChI=1S/C12H18N2O4/c1-7(5-4-6-10(15)16)13-12(17)11-8(2)14-18-9(11)3/h7H,4-6H2,1-3H3,(H,13,17)(H,15,16)
InChIKeyFMGLEPPFPXLRFB-UHFFFAOYSA-N
XLogP1.66
TPSA92.43 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500254.29
LogP ≤ 51.66
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 5-[(3,5-dimethyl-1,2-oxazole-4-carbonyl)amino]hexanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-[(3,5-dimethyl-1,2-oxazole-4-carbonyl)amino]hexanoic acid?
The IUPAC name of 5-[(3,5-dimethyl-1,2-oxazole-4-carbonyl)amino]hexanoic acid (CID 82854561) is 5-[(3,5-dimethyl-1,2-oxazole-4-carbonyl)amino]hexanoic acid.
What is the SMILES notation for 5-[(3,5-dimethyl-1,2-oxazole-4-carbonyl)amino]hexanoic acid?
The canonical SMILES for 5-[(3,5-dimethyl-1,2-oxazole-4-carbonyl)amino]hexanoic acid is Cc1noc(C)c1C(=O)NC(C)CCCC(=O)O.
What is the InChIKey of 5-[(3,5-dimethyl-1,2-oxazole-4-carbonyl)amino]hexanoic acid?
The InChIKey is FMGLEPPFPXLRFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2O4/c1-7(5-4-6-10(15)16)13-12(17)11-8(2)14-18-9(11)3/h7H,4-6H2,1-3H3,(H,13,17)(H,15,16).
What are the key properties of 5-[(3,5-dimethyl-1,2-oxazole-4-carbonyl)amino]hexanoic acid?
5-[(3,5-dimethyl-1,2-oxazole-4-carbonyl)amino]hexanoic acid has a molecular weight of 254.29 g/mol, XLogP of 1.66, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(3,5-dimethyl-1,2-oxazole-4-carbonyl)amino]hexanoic acid is sourced from PubChem (CID 82854561), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).