C26H26N6O4 — CID 17220112
4-morpholin-4-yl-3-nitro-N-[2-(4-propan-2-ylphenyl)benzotriazol-5-yl]benzamide (PubChem CID 17220112) has the molecular formula C26H26N6O4 and a molecular weight of 486.53 g/mol. Its IUPAC name is 4-morpholin-4-yl-3-nitro-N-[2-(4-propan-2-ylphenyl)benzotriazol-5-yl]benzamide.
| Compound Name | 4-morpholin-4-yl-3-nitro-N-[2-(4-propan-2-ylphenyl)benzotriazol-5-yl]benzamide |
|---|---|
| PubChem CID | 17220112 |
| Molecular Formula | C26H26N6O4 |
| Molecular Weight | 486.53 g/mol |
| Exact Mass | 486.20 |
| IUPAC Name | 4-morpholin-4-yl-3-nitro-N-[2-(4-propan-2-ylphenyl)benzotriazol-5-yl]benzamide |
| SMILES | CC(C)c1ccc(-n2nc3ccc(NC(=O)c4ccc(N5CCOCC5)c([N+](=O)[O-])c4)cc3n2)cc1 |
| InChI | InChI=1S/C26H26N6O4/c1-17(2)18-3-7-21(8-4-18)31-28-22-9-6-20(16-23(22)29-31)27-26(33)19-5-10-24(25(15-19)32(34)35)30-11-13-36-14-12-30/h3-10,15-17H,11-14H2,1-2H3,(H,27,33) |
| InChIKey | SGOKSUXZCZIPKJ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 115.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.53 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|