C17H18N4O4 — CID 17221406
2-hydrazinyl-6,7-dimethoxy-3-(2-methoxyphenyl)quinazolin-4-one (PubChem CID 17221406) has the molecular formula C17H18N4O4 and a molecular weight of 342.36 g/mol. Its IUPAC name is 2-hydrazinyl-6,7-dimethoxy-3-(2-methoxyphenyl)quinazolin-4-one.
| Compound Name | 2-hydrazinyl-6,7-dimethoxy-3-(2-methoxyphenyl)quinazolin-4-one |
|---|---|
| PubChem CID | 17221406 |
| Molecular Formula | C17H18N4O4 |
| Molecular Weight | 342.36 g/mol |
| Exact Mass | 342.13 |
| IUPAC Name | 2-hydrazinyl-6,7-dimethoxy-3-(2-methoxyphenyl)quinazolin-4-one |
| SMILES | COc1cc2nc(NN)n(-c3ccccc3OC)c(=O)c2cc1OC |
| InChI | InChI=1S/C17H18N4O4/c1-23-13-7-5-4-6-12(13)21-16(22)10-8-14(24-2)15(25-3)9-11(10)19-17(21)20-18/h4-9H,18H2,1-3H3,(H,19,20) |
| InChIKey | SOWYRSHIRKYWQA-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 100.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.36 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|