C18H18BrN3O3S — CID 17230990
5-bromo-N-[[3-(ethylcarbamoyl)phenyl]carbamothioyl]-2-methoxybenzamide (PubChem CID 17230990) has the molecular formula C18H18BrN3O3S and a molecular weight of 436.33 g/mol. Its IUPAC name is 5-bromo-N-[[3-(ethylcarbamoyl)phenyl]carbamothioyl]-2-methoxybenzamide.
| Compound Name | 5-bromo-N-[[3-(ethylcarbamoyl)phenyl]carbamothioyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 17230990 |
| Molecular Formula | C18H18BrN3O3S |
| Molecular Weight | 436.33 g/mol |
| Exact Mass | 435.03 |
| IUPAC Name | 5-bromo-N-[[3-(ethylcarbamoyl)phenyl]carbamothioyl]-2-methoxybenzamide |
| SMILES | CCNC(=O)c1cccc(NC(=S)NC(=O)c2cc(Br)ccc2OC)c1 |
| InChI | InChI=1S/C18H18BrN3O3S/c1-3-20-16(23)11-5-4-6-13(9-11)21-18(26)22-17(24)14-10-12(19)7-8-15(14)25-2/h4-10H,3H2,1-2H3,(H,20,23)(H2,21,22,24,26) |
| InChIKey | GIJIVMHNEURGEO-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.33 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|