C20H19N5O6S — CID 17232886
(E)-N-[[[1-(furan-2-ylmethyl)-5-oxopyrrolidine-3-carbonyl]amino]carbamothioyl]-3-(3-nitrophenyl)prop-2-enamide (PubChem CID 17232886) has the molecular formula C20H19N5O6S and a molecular weight of 457.47 g/mol. Its IUPAC name is (E)-N-[[[1-(furan-2-ylmethyl)-5-oxopyrrolidine-3-carbonyl]amino]carbamothioyl]-3-(3-nitrophenyl)prop-2-enamide.
| Compound Name | (E)-N-[[[1-(furan-2-ylmethyl)-5-oxopyrrolidine-3-carbonyl]amino]carbamothioyl]-3-(3-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 17232886 |
| Molecular Formula | C20H19N5O6S |
| Molecular Weight | 457.47 g/mol |
| Exact Mass | 457.11 |
| IUPAC Name | (E)-N-[[[1-(furan-2-ylmethyl)-5-oxopyrrolidine-3-carbonyl]amino]carbamothioyl]-3-(3-nitrophenyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1cccc([N+](=O)[O-])c1)NC(=S)NNC(=O)C1CC(=O)N(Cc2ccco2)C1 |
| InChI | InChI=1S/C20H19N5O6S/c26-17(7-6-13-3-1-4-15(9-13)25(29)30)21-20(32)23-22-19(28)14-10-18(27)24(11-14)12-16-5-2-8-31-16/h1-9,14H,10-12H2,(H,22,28)(H2,21,23,26,32)/b7-6+ |
| InChIKey | BEZSRVPEWGEQFQ-VOTSOKGWSA-N |
| XLogP | 1.27 |
| TPSA | 146.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.47 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|