C16H16N4O5S — CID 17232788
N-[[[1-(furan-2-ylmethyl)-5-oxopyrrolidine-3-carbonyl]amino]carbamothioyl]furan-2-carboxamide (PubChem CID 17232788) has the molecular formula C16H16N4O5S and a molecular weight of 376.39 g/mol. Its IUPAC name is N-[[[1-(furan-2-ylmethyl)-5-oxopyrrolidine-3-carbonyl]amino]carbamothioyl]furan-2-carboxamide.
| Compound Name | N-[[[1-(furan-2-ylmethyl)-5-oxopyrrolidine-3-carbonyl]amino]carbamothioyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 17232788 |
| Molecular Formula | C16H16N4O5S |
| Molecular Weight | 376.39 g/mol |
| Exact Mass | 376.08 |
| IUPAC Name | N-[[[1-(furan-2-ylmethyl)-5-oxopyrrolidine-3-carbonyl]amino]carbamothioyl]furan-2-carboxamide |
| SMILES | O=C(NC(=S)NNC(=O)C1CC(=O)N(Cc2ccco2)C1)c1ccco1 |
| InChI | InChI=1S/C16H16N4O5S/c21-13-7-10(8-20(13)9-11-3-1-5-24-11)14(22)18-19-16(26)17-15(23)12-4-2-6-25-12/h1-6,10H,7-9H2,(H,18,22)(H2,17,19,23,26) |
| InChIKey | XWVNQYAUAQJOBU-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 116.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.39 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|