C23H28N4O5S — CID 17232838
N-[[[1-(furan-2-ylmethyl)-5-oxopyrrolidine-3-carbonyl]amino]carbamothioyl]-4-(3-methylbutoxy)benzamide (PubChem CID 17232838) has the molecular formula C23H28N4O5S and a molecular weight of 472.57 g/mol. Its IUPAC name is N-[[[1-(furan-2-ylmethyl)-5-oxopyrrolidine-3-carbonyl]amino]carbamothioyl]-4-(3-methylbutoxy)benzamide.
| Compound Name | N-[[[1-(furan-2-ylmethyl)-5-oxopyrrolidine-3-carbonyl]amino]carbamothioyl]-4-(3-methylbutoxy)benzamide |
|---|---|
| PubChem CID | 17232838 |
| Molecular Formula | C23H28N4O5S |
| Molecular Weight | 472.57 g/mol |
| Exact Mass | 472.18 |
| IUPAC Name | N-[[[1-(furan-2-ylmethyl)-5-oxopyrrolidine-3-carbonyl]amino]carbamothioyl]-4-(3-methylbutoxy)benzamide |
| SMILES | CC(C)CCOc1ccc(C(=O)NC(=S)NNC(=O)C2CC(=O)N(Cc3ccco3)C2)cc1 |
| InChI | InChI=1S/C23H28N4O5S/c1-15(2)9-11-32-18-7-5-16(6-8-18)21(29)24-23(33)26-25-22(30)17-12-20(28)27(13-17)14-19-4-3-10-31-19/h3-8,10,15,17H,9,11-14H2,1-2H3,(H,25,30)(H2,24,26,29,33) |
| InChIKey | VLFAZYHKOWVMOK-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 112.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.57 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|