C22H26N4O5S — CID 17232832
2-butoxy-N-[[[1-(furan-2-ylmethyl)-5-oxopyrrolidine-3-carbonyl]amino]carbamothioyl]benzamide (PubChem CID 17232832) has the molecular formula C22H26N4O5S and a molecular weight of 458.54 g/mol. Its IUPAC name is 2-butoxy-N-[[[1-(furan-2-ylmethyl)-5-oxopyrrolidine-3-carbonyl]amino]carbamothioyl]benzamide.
| Compound Name | 2-butoxy-N-[[[1-(furan-2-ylmethyl)-5-oxopyrrolidine-3-carbonyl]amino]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 17232832 |
| Molecular Formula | C22H26N4O5S |
| Molecular Weight | 458.54 g/mol |
| Exact Mass | 458.16 |
| IUPAC Name | 2-butoxy-N-[[[1-(furan-2-ylmethyl)-5-oxopyrrolidine-3-carbonyl]amino]carbamothioyl]benzamide |
| SMILES | CCCCOc1ccccc1C(=O)NC(=S)NNC(=O)C1CC(=O)N(Cc2ccco2)C1 |
| InChI | InChI=1S/C22H26N4O5S/c1-2-3-10-31-18-9-5-4-8-17(18)21(29)23-22(32)25-24-20(28)15-12-19(27)26(13-15)14-16-7-6-11-30-16/h4-9,11,15H,2-3,10,12-14H2,1H3,(H,24,28)(H2,23,25,29,32) |
| InChIKey | BJUPIYILGWDWHY-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 112.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.54 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|