C26H25BrN4O5S — CID 17232871
3-bromo-N-[[[1-(furan-2-ylmethyl)-5-oxopyrrolidine-3-carbonyl]amino]carbamothioyl]-4-(2-phenylethoxy)benzamide (PubChem CID 17232871) has the molecular formula C26H25BrN4O5S and a molecular weight of 585.48 g/mol. Its IUPAC name is 3-bromo-N-[[[1-(furan-2-ylmethyl)-5-oxopyrrolidine-3-carbonyl]amino]carbamothioyl]-4-(2-phenylethoxy)benzamide.
| Compound Name | 3-bromo-N-[[[1-(furan-2-ylmethyl)-5-oxopyrrolidine-3-carbonyl]amino]carbamothioyl]-4-(2-phenylethoxy)benzamide |
|---|---|
| PubChem CID | 17232871 |
| Molecular Formula | C26H25BrN4O5S |
| Molecular Weight | 585.48 g/mol |
| Exact Mass | 584.07 |
| IUPAC Name | 3-bromo-N-[[[1-(furan-2-ylmethyl)-5-oxopyrrolidine-3-carbonyl]amino]carbamothioyl]-4-(2-phenylethoxy)benzamide |
| SMILES | O=C(NC(=S)NNC(=O)C1CC(=O)N(Cc2ccco2)C1)c1ccc(OCCc2ccccc2)c(Br)c1 |
| InChI | InChI=1S/C26H25BrN4O5S/c27-21-13-18(8-9-22(21)36-12-10-17-5-2-1-3-6-17)24(33)28-26(37)30-29-25(34)19-14-23(32)31(15-19)16-20-7-4-11-35-20/h1-9,11,13,19H,10,12,14-16H2,(H,29,34)(H2,28,30,33,37) |
| InChIKey | GMIXPOPZNBEZBV-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 112.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.48 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|