C18H18N2O2S — CID 17237386
6-methyl-4-(3-methylthiophen-2-yl)-9-nitro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline (PubChem CID 17237386) has the molecular formula C18H18N2O2S and a molecular weight of 326.42 g/mol. Its IUPAC name is 6-methyl-4-(3-methylthiophen-2-yl)-9-nitro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline.
| Compound Name | 6-methyl-4-(3-methylthiophen-2-yl)-9-nitro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
|---|---|
| PubChem CID | 17237386 |
| Molecular Formula | C18H18N2O2S |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | 6-methyl-4-(3-methylthiophen-2-yl)-9-nitro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline |
| SMILES | Cc1ccsc1C1Nc2c(C)ccc([N+](=O)[O-])c2C2C=CCC21 |
| InChI | InChI=1S/C18H18N2O2S/c1-10-6-7-14(20(21)22)15-12-4-3-5-13(12)17(19-16(10)15)18-11(2)8-9-23-18/h3-4,6-9,12-13,17,19H,5H2,1-2H3 |
| InChIKey | HNCZDTWLCJJAEX-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|