C23H27N3O2 — CID 17238876
N,N-diethyl-4-(6-methyl-9-nitro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl)aniline (PubChem CID 17238876) has the molecular formula C23H27N3O2 and a molecular weight of 377.49 g/mol. Its IUPAC name is N,N-diethyl-4-(6-methyl-9-nitro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl)aniline.
| Compound Name | N,N-diethyl-4-(6-methyl-9-nitro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl)aniline |
|---|---|
| PubChem CID | 17238876 |
| Molecular Formula | C23H27N3O2 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | N,N-diethyl-4-(6-methyl-9-nitro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl)aniline |
| SMILES | CCN(CC)c1ccc(C2Nc3c(C)ccc([N+](=O)[O-])c3C3C=CCC32)cc1 |
| InChI | InChI=1S/C23H27N3O2/c1-4-25(5-2)17-12-10-16(11-13-17)23-19-8-6-7-18(19)21-20(26(27)28)14-9-15(3)22(21)24-23/h6-7,9-14,18-19,23-24H,4-5,8H2,1-3H3 |
| InChIKey | VYTPHARSQHWHJU-UHFFFAOYSA-N |
| XLogP | 5.58 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|