C22H24FN3O2 — CID 17238891
N,N-diethyl-4-(6-fluoro-9-nitro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl)aniline (PubChem CID 17238891) has the molecular formula C22H24FN3O2 and a molecular weight of 381.45 g/mol. Its IUPAC name is N,N-diethyl-4-(6-fluoro-9-nitro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl)aniline.
| Compound Name | N,N-diethyl-4-(6-fluoro-9-nitro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl)aniline |
|---|---|
| PubChem CID | 17238891 |
| Molecular Formula | C22H24FN3O2 |
| Molecular Weight | 381.45 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | N,N-diethyl-4-(6-fluoro-9-nitro-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinolin-4-yl)aniline |
| SMILES | CCN(CC)c1ccc(C2Nc3c(F)ccc([N+](=O)[O-])c3C3C=CCC32)cc1 |
| InChI | InChI=1S/C22H24FN3O2/c1-3-25(4-2)15-10-8-14(9-11-15)21-17-7-5-6-16(17)20-19(26(27)28)13-12-18(23)22(20)24-21/h5-6,8-13,16-17,21,24H,3-4,7H2,1-2H3 |
| InChIKey | UPBHEHXAIJZSTH-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.45 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|